Synthesis and Characterization of Indium Compounds with Phosphinothiol Ligands. The Crystal and Molecular Structures of [In{2-(Ph(2)P)C(6)H(4)S}(3)], [In{2-(Ph(2)P)-6-(Me(3)Si)C(6)H(3)S}(2){2-(Ph(2)PO)-6-(Me(3)Si)C(6)H(3)S}], and [NMe(4)][In{PhP(C(6)H(4)S-2)(2)}(2)].CH(3)CN.

The electrochemical oxidation of anodic indium metal in an acetonitrile solution of phosphinothiol ligands affords [In{2-(Ph(2)P)C(6)H(4)S}(3)] (1), [In{2-(Ph(2)P)-6-(Me(3)Si)C(6)H(3)S)}(2){2-(Ph(2)PO)-6-(Me(3)Si)C(6)H(3)S}] (2), [In{2-(Ph(2)PO)-6-(Me(3)Si)C(6)H(3)S}(3)] (3), and [NMe(4)][In{PhP(C(6)H(4)S-2)(2)}(2)].CH(3)CN (4) complexes exhibiting distorted six-coordinate geometries based on {InS(3)P(3)}, {InS(3)P(2)O}, and {InS(4)P(2)} cores, respectively. In all cases, the In-P bond distances are anomalously long, presumably as a consequence of steric crowding. The anion of 4 provides an unusual example of an In(III)-thiolate coordination complex ion. Crystal data: 1, C(54)H(42)InP(3)S(3), monoclinic, P2(1)/c, a = 16.6579(1) Å, b = 12.6628(2) Å, c = 22.5520(3) Å, beta = 96.42(1) degrees, V = 4727.15(1) Å(3), Z = 4, 6176 reflections, R = 0.0579; 2, C(63)H(66)InOP(3)S(3)Si(3), monoclinic, P2(1)/c, a = 11.53090(10) Å, b = 26.2505(3) Å, c = 20.4206(2) Å, beta = 94.0870(10) degrees, V = 6165.43(11) Å(3), Z = 4, 10 699 reflections, R = 0.0621; 4, C(42)H(41)InN(2)P(2)S(4), monoclinic, P2(1), a = 13.0052(2) Å, b = 11.2240(2) Å, c = 14.3070(3) Å, beta = 93.190(1) degrees, V = 2085.16(7) Å(3), Z = 2, 6651 reflections, R = 0.0352.