Charge transport properties of tris(8-hydroxyquinolinato)aluminum(III): why it is an electron transporter.

The charge transport properties of mer-tris(8-hydroxyquinolinato)aluminum(III) (mer-Alq), which is the most widely used electron transport material in OLED, were investigated by quantum chemistry calculations within the framework of the charge hopping model and Marcus electron transfer theory. Internal reorganization energies of 0.276 and 0.

Structure of Dicopper Complexes of N,N,N',N'-Tetrakis[(2-benzimidazolyl)methyl]-2-hydroxy-1,3-diaminopropane with Coordinated Thiocyanate Counterions.

The structures of five dicopper complexes of binucleating ligand HL-H (N,N,N',N'-tetrakis[(2-benzimidazolyl)methyl]-2-hydroxy-1,3-diaminopropane) with thiocyanate and some other counterions were investigated by the X-ray diffraction method. In Cu(2)(HL-H)(NCS)(2)Cl(2).6H(2)O.