Thermodynamic aspects of solubility process of some sulfonamides.

The thermodynamic aspects of solubility process of sulfonamides with the general structures C(6)H(5)-SO(2)NH-C(6)H(4)-R (R=4-NO(2); 4-Cl) and 4-NH(2)-C(6)H(4)-SO(2)NH-C(6)H(4)-R (R=4-NO(2); 4-CN; 4-Cl; 4-OMe; 4-C(2)H(5)) in water, phosphate buffer with pH 7.4 and n-octanol (as phases modeling various drug delivery pathways) were studied using the isothermal saturated method.